C19H21N5O2 — CID 9120452
3,6,6-trimethyl-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-1H-indole-2-carboxamide (PubChem CID 9120452) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3,6,6-trimethyl-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-1H-indole-2-carboxamide.
| Compound Name | 3,6,6-trimethyl-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 9120452 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3,6,6-trimethyl-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-5,7-dihydro-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2nnc3ccccn23)[nH]c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H21N5O2/c1-11-16-12(8-19(2,3)9-13(16)25)21-17(11)18(26)20-10-15-23-22-14-6-4-5-7-24(14)15/h4-7,21H,8-10H2,1-3H3,(H,20,26) |
| InChIKey | UNMFHDCIVFAKBC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |