C23H30N2O3 — CID 24678094
3,6,6-trimethyl-4-oxo-N-[3-(1-phenylethoxy)propyl]-5,7-dihydro-1H-indole-2-carboxamide (PubChem CID 24678094) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3,6,6-trimethyl-4-oxo-N-[3-(1-phenylethoxy)propyl]-5,7-dihydro-1H-indole-2-carboxamide.
| Compound Name | 3,6,6-trimethyl-4-oxo-N-[3-(1-phenylethoxy)propyl]-5,7-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 24678094 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3,6,6-trimethyl-4-oxo-N-[3-(1-phenylethoxy)propyl]-5,7-dihydro-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCOC(C)c2ccccc2)[nH]c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C23H30N2O3/c1-15-20-18(13-23(3,4)14-19(20)26)25-21(15)22(27)24-11-8-12-28-16(2)17-9-6-5-7-10-17/h5-7,9-10,16,25H,8,11-14H2,1-4H3,(H,24,27) |
| InChIKey | GGOBRXDDJXUXQN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|