C31H28N4O3 — CID 91205469
N-[3-[[hydroxy(phenyl)methyl]amino]-4-(5-methyl-3-phenylpyrazol-1-yl)phenyl]-4-methoxybenzamide (PubChem CID 91205469) has the molecular formula C31H28N4O3 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[3-[[hydroxy(phenyl)methyl]amino]-4-(5-methyl-3-phenylpyrazol-1-yl)phenyl]-4-methoxybenzamide.
| Compound Name | N-[3-[[hydroxy(phenyl)methyl]amino]-4-(5-methyl-3-phenylpyrazol-1-yl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 91205469 |
| Molecular Formula | C31H28N4O3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | N-[3-[[hydroxy(phenyl)methyl]amino]-4-(5-methyl-3-phenylpyrazol-1-yl)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-n3nc(-c4ccccc4)cc3C)c(NC(O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H28N4O3/c1-21-19-27(22-9-5-3-6-10-22)34-35(21)29-18-15-25(32-30(36)24-13-16-26(38-2)17-14-24)20-28(29)33-31(37)23-11-7-4-8-12-23/h3-20,31,33,37H,1-2H3,(H,32,36) |
| InChIKey | XJGDPOGGWCIZHY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|