C56H38F6I2O8S — CID 91206144
3-[5-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]-2-methylbenzoyl]benzenesulfonic acid;molecular iodine (PubChem CID 91206144) has the molecular formula C56H38F6I2O8S and a molecular weight of 1238.77 g/mol. Its IUPAC name is 3-[5-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]-2-methylbenzoyl]benzenesulfonic acid;molecular iodine.
| Compound Name | 3-[5-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]-2-methylbenzoyl]benzenesulfonic acid;molecular iodine |
|---|---|
| PubChem CID | 91206144 |
| Molecular Formula | C56H38F6I2O8S |
| Molecular Weight | 1238.77 g/mol |
| Exact Mass | 1238.03 |
| IUPAC Name | 3-[5-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]phenoxy]benzoyl]phenyl]-2-methylbenzoyl]benzenesulfonic acid;molecular iodine |
| SMILES | Cc1ccc(C(=O)c2ccc(Oc3ccc(C(c4ccc(Oc5ccc(C(=O)c6ccc(-c7ccc(C)c(C(=O)c8cccc(S(=O)(=O)O)c8)c7)cc6)cc5)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1.II |
| InChI | InChI=1S/C56H38F6O8S.I2/c1-34-6-9-37(10-7-34)51(63)39-16-24-45(25-17-39)69-47-28-20-43(21-29-47)54(55(57,58)59,56(60,61)62)44-22-30-48(31-23-44)70-46-26-18-40(19-27-46)52(64)38-14-12-36(13-15-38)41-11-8-35(2)50(33-41)53(65)42-4-3-5-49(32-42)71(66,67)68;1-2/h3-33H,1-2H3,(H,66,67,68); |
| InChIKey | TVVSKBNXMFSKGJ-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1238.77 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|