C18H39NO2S — CID 91206934
3-ethyl-3-[(3-ethyl-2,2-dimethylpentan-3-yl)-sulfinoamino]-2,2-dimethylpentane (PubChem CID 91206934) has the molecular formula C18H39NO2S and a molecular weight of 333.58 g/mol. Its IUPAC name is 3-ethyl-3-[(3-ethyl-2,2-dimethylpentan-3-yl)-sulfinoamino]-2,2-dimethylpentane.
| Compound Name | 3-ethyl-3-[(3-ethyl-2,2-dimethylpentan-3-yl)-sulfinoamino]-2,2-dimethylpentane |
|---|---|
| PubChem CID | 91206934 |
| Molecular Formula | C18H39NO2S |
| Molecular Weight | 333.58 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 3-ethyl-3-[(3-ethyl-2,2-dimethylpentan-3-yl)-sulfinoamino]-2,2-dimethylpentane |
| SMILES | CCC(CC)(N(S(=O)O)C(CC)(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H39NO2S/c1-11-17(12-2,15(5,6)7)19(22(20)21)18(13-3,14-4)16(8,9)10/h11-14H2,1-10H3,(H,20,21) |
| InChIKey | PEAMYACLSAPOAR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|