C18H19N3O4 — CID 91207736
2-[2-[4-(4-nitrophenyl)phenyl]piperazin-1-yl]acetic acid (PubChem CID 91207736) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[2-[4-(4-nitrophenyl)phenyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[2-[4-(4-nitrophenyl)phenyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 91207736 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[2-[4-(4-nitrophenyl)phenyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCNCC1c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H19N3O4/c22-18(23)12-20-10-9-19-11-17(20)15-3-1-13(2-4-15)14-5-7-16(8-6-14)21(24)25/h1-8,17,19H,9-12H2,(H,22,23) |
| InChIKey | YDAOIOPSEKMZQI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|