C24H29N3O5 — CID 69000282
(6-hydroxy-2,3,3,4-tetramethyl-4H-chromen-2-yl)-[2-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 69000282) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (6-hydroxy-2,3,3,4-tetramethyl-4H-chromen-2-yl)-[2-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (6-hydroxy-2,3,3,4-tetramethyl-4H-chromen-2-yl)-[2-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 69000282 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (6-hydroxy-2,3,3,4-tetramethyl-4H-chromen-2-yl)-[2-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | CC1c2cc(O)ccc2OC(C)(C(=O)N2CCNCC2c2ccc([N+](=O)[O-])cc2)C1(C)C |
| InChI | InChI=1S/C24H29N3O5/c1-15-19-13-18(28)9-10-21(19)32-24(4,23(15,2)3)22(29)26-12-11-25-14-20(26)16-5-7-17(8-6-16)27(30)31/h5-10,13,15,20,25,28H,11-12,14H2,1-4H3 |
| InChIKey | RWFFVDCIGHPLTJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|