C16H24O4S — CID 91207982
1-[[3-(1-hydroxybutyl)phenyl]sulfonylmethyl]cyclopentan-1-ol (PubChem CID 91207982) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is 1-[[3-(1-hydroxybutyl)phenyl]sulfonylmethyl]cyclopentan-1-ol.
| Compound Name | 1-[[3-(1-hydroxybutyl)phenyl]sulfonylmethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 91207982 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[[3-(1-hydroxybutyl)phenyl]sulfonylmethyl]cyclopentan-1-ol |
| SMILES | CCCC(O)c1cccc(S(=O)(=O)CC2(O)CCCC2)c1 |
| InChI | InChI=1S/C16H24O4S/c1-2-6-15(17)13-7-5-8-14(11-13)21(19,20)12-16(18)9-3-4-10-16/h5,7-8,11,15,17-18H,2-4,6,9-10,12H2,1H3 |
| InChIKey | PMWONSACHBFKJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |