C22H30O7 — CID 91208357
2-phenylmethoxy-3-(2-phenylmethoxyethoxy)hexane-1,3,4,6-tetrol (PubChem CID 91208357) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-phenylmethoxy-3-(2-phenylmethoxyethoxy)hexane-1,3,4,6-tetrol.
| Compound Name | 2-phenylmethoxy-3-(2-phenylmethoxyethoxy)hexane-1,3,4,6-tetrol |
|---|---|
| PubChem CID | 91208357 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-phenylmethoxy-3-(2-phenylmethoxyethoxy)hexane-1,3,4,6-tetrol |
| SMILES | OCCC(O)C(O)(OCCOCc1ccccc1)C(CO)OCc1ccccc1 |
| InChI | InChI=1S/C22H30O7/c23-12-11-20(25)22(26,21(15-24)28-17-19-9-5-2-6-10-19)29-14-13-27-16-18-7-3-1-4-8-18/h1-10,20-21,23-26H,11-17H2 |
| InChIKey | BCFRBNACUDBVTG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|