C12H19NO — CID 91210077
1-cyclohexyl-4-methyl-2,3-dihydropyridin-6-one (PubChem CID 91210077) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-cyclohexyl-4-methyl-2,3-dihydropyridin-6-one.
| Compound Name | 1-cyclohexyl-4-methyl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 91210077 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-cyclohexyl-4-methyl-2,3-dihydropyridin-6-one |
| SMILES | CC1=CC(=O)N(C2CCCCC2)CC1 |
| InChI | InChI=1S/C12H19NO/c1-10-7-8-13(12(14)9-10)11-5-3-2-4-6-11/h9,11H,2-8H2,1H3 |
| InChIKey | JVOWBEXSVGJWMW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |