C13H19N3O — CID 91210242
3-piperidin-4-yl-4,4a,5,8-tetrahydroquinazolin-2-one (PubChem CID 91210242) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-piperidin-4-yl-4,4a,5,8-tetrahydroquinazolin-2-one.
| Compound Name | 3-piperidin-4-yl-4,4a,5,8-tetrahydroquinazolin-2-one |
|---|---|
| PubChem CID | 91210242 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-piperidin-4-yl-4,4a,5,8-tetrahydroquinazolin-2-one |
| SMILES | O=C1N=C2CC=CCC2CN1C1CCNCC1 |
| InChI | InChI=1S/C13H19N3O/c17-13-15-12-4-2-1-3-10(12)9-16(13)11-5-7-14-8-6-11/h1-2,10-11,14H,3-9H2 |
| InChIKey | MLJCVBNSGZRVLK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|