C17H30FN3O3 — CID 91210723
tert-butyl (4S)-4-[5-(1-aminoethylideneamino)-3-fluoropent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 91210723) has the molecular formula C17H30FN3O3 and a molecular weight of 343.44 g/mol. Its IUPAC name is tert-butyl (4S)-4-[5-(1-aminoethylideneamino)-3-fluoropent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[5-(1-aminoethylideneamino)-3-fluoropent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 91210723 |
| Molecular Formula | C17H30FN3O3 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | tert-butyl (4S)-4-[5-(1-aminoethylideneamino)-3-fluoropent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C(N)=N\CCC(F)=CC[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30FN3O3/c1-12(19)20-10-9-13(18)7-8-14-11-23-17(5,6)21(14)15(22)24-16(2,3)4/h7,14H,8-11H2,1-6H3,(H2,19,20)/t14-/m0/s1 |
| InChIKey | NYMDWSLFOGILNL-AWEZNQCLSA-N |
| XLogP | 3.37 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|