C13H24FN3O — CID 91395293
N'-[3-fluoro-5-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]pent-3-enyl]ethanimidamide (PubChem CID 91395293) has the molecular formula C13H24FN3O and a molecular weight of 257.35 g/mol. Its IUPAC name is N'-[3-fluoro-5-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]pent-3-enyl]ethanimidamide.
| Compound Name | N'-[3-fluoro-5-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]pent-3-enyl]ethanimidamide |
|---|---|
| PubChem CID | 91395293 |
| Molecular Formula | C13H24FN3O |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N'-[3-fluoro-5-[(4S)-2,2,3-trimethyl-1,3-oxazolidin-4-yl]pent-3-enyl]ethanimidamide |
| SMILES | C/C(N)=N\CCC(F)=CC[C@H]1COC(C)(C)N1C |
| InChI | InChI=1S/C13H24FN3O/c1-10(15)16-8-7-11(14)5-6-12-9-18-13(2,3)17(12)4/h5,12H,6-9H2,1-4H3,(H2,15,16)/t12-/m0/s1 |
| InChIKey | IGUIDNZXNVAFAF-LBPRGKRZSA-N |
| XLogP | 2.06 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|