C28H35NO5 — CID 91210869
7-[(2R)-2-[(3R)-3-hydroxy-3-[3-(4-hydroxy-2-methylphenyl)phenyl]prop-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid (PubChem CID 91210869) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is 7-[(2R)-2-[(3R)-3-hydroxy-3-[3-(4-hydroxy-2-methylphenyl)phenyl]prop-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(3R)-3-hydroxy-3-[3-(4-hydroxy-2-methylphenyl)phenyl]prop-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 91210869 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 7-[(2R)-2-[(3R)-3-hydroxy-3-[3-(4-hydroxy-2-methylphenyl)phenyl]prop-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid |
| SMILES | Cc1cc(O)ccc1-c1cccc([C@H](O)C=C[C@H]2CCCC(=O)N2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C28H35NO5/c1-20-18-24(30)14-15-25(20)21-8-6-9-22(19-21)26(31)16-13-23-10-7-11-27(32)29(23)17-5-3-2-4-12-28(33)34/h6,8-9,13-16,18-19,23,26,30-31H,2-5,7,10-12,17H2,1H3,(H,33,34)/t23-,26-/m1/s1 |
| InChIKey | KICBNVWWOFWPIV-ZEQKJWHPSA-N |
| XLogP | 5.37 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|