C14H26O — CID 91211835
1-(4,4-dimethylpent-1-enoxy)-4,4-dimethylpent-1-ene (PubChem CID 91211835) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(4,4-dimethylpent-1-enoxy)-4,4-dimethylpent-1-ene.
| Compound Name | 1-(4,4-dimethylpent-1-enoxy)-4,4-dimethylpent-1-ene |
|---|---|
| PubChem CID | 91211835 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-(4,4-dimethylpent-1-enoxy)-4,4-dimethylpent-1-ene |
| SMILES | CC(C)(C)CC=COC=CCC(C)(C)C |
| InChI | InChI=1S/C14H26O/c1-13(2,3)9-7-11-15-12-8-10-14(4,5)6/h7-8,11-12H,9-10H2,1-6H3 |
| InChIKey | MWRJJEDQKZWLGY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|