C14H15ClO2 — CID 91213709
7-methoxy-7-phenylhepta-2,4-dienoyl chloride (PubChem CID 91213709) has the molecular formula C14H15ClO2 and a molecular weight of 250.73 g/mol. Its IUPAC name is 7-methoxy-7-phenylhepta-2,4-dienoyl chloride.
| Compound Name | 7-methoxy-7-phenylhepta-2,4-dienoyl chloride |
|---|---|
| PubChem CID | 91213709 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 7-methoxy-7-phenylhepta-2,4-dienoyl chloride |
| SMILES | COC(CC=CC=CC(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H15ClO2/c1-17-13(12-8-4-2-5-9-12)10-6-3-7-11-14(15)16/h2-9,11,13H,10H2,1H3 |
| InChIKey | FVVAUDRUDYCULO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|