C17H16F3N3O2 — CID 91214260
1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(trifluoromethyl)pyrrole-2,3-diol (PubChem CID 91214260) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(trifluoromethyl)pyrrole-2,3-diol.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(trifluoromethyl)pyrrole-2,3-diol |
|---|---|
| PubChem CID | 91214260 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-4-phenyl-5-(trifluoromethyl)pyrrole-2,3-diol |
| SMILES | Oc1c(-c2ccccc2)c(C(F)(F)F)n(CCCn2ccnc2)c1O |
| InChI | InChI=1S/C17H16F3N3O2/c18-17(19,20)15-13(12-5-2-1-3-6-12)14(24)16(25)23(15)9-4-8-22-10-7-21-11-22/h1-3,5-7,10-11,24-25H,4,8-9H2 |
| InChIKey | PVVIHXGCNGXAIE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |