C14H18N2 — CID 91216554
3-N-[(E)-2-(4-methylphenyl)prop-1-enyl]butane-2,3-diimine (PubChem CID 91216554) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-N-[(E)-2-(4-methylphenyl)prop-1-enyl]butane-2,3-diimine.
| Compound Name | 3-N-[(E)-2-(4-methylphenyl)prop-1-enyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 91216554 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-N-[(E)-2-(4-methylphenyl)prop-1-enyl]butane-2,3-diimine |
| SMILES | [H]/N=C(C)/C(C)=N/C=C(\C)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18N2/c1-10-5-7-14(8-6-10)11(2)9-16-13(4)12(3)15/h5-9,15H,1-4H3/b11-9+,15-12+,16-13+ |
| InChIKey | SBADQCYJCXUIFD-BDBHLZKASA-N |
| XLogP | 3.86 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|