C14H15NO3 — CID 135449055
(3Z)-3-(1-hydroxyethylidene)-2-imino-1-(4-methylphenyl)pentane-1,4-dione (PubChem CID 135449055) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (3Z)-3-(1-hydroxyethylidene)-2-imino-1-(4-methylphenyl)pentane-1,4-dione.
| Compound Name | (3Z)-3-(1-hydroxyethylidene)-2-imino-1-(4-methylphenyl)pentane-1,4-dione |
|---|---|
| PubChem CID | 135449055 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (3Z)-3-(1-hydroxyethylidene)-2-imino-1-(4-methylphenyl)pentane-1,4-dione |
| SMILES | [H]/N=C(C(=O)c1ccc(C)cc1)\C(C(C)=O)=C(/C)O |
| InChI | InChI=1S/C14H15NO3/c1-8-4-6-11(7-5-8)14(18)13(15)12(9(2)16)10(3)17/h4-7,15-16H,1-3H3/b12-9+,15-13+ |
| InChIKey | OMKGDNLEMTVNLE-QQFPHPJOSA-N |
| XLogP | 2.62 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|