C18H17NO2 — CID 123907711
2-imino-1-(4-phenylphenyl)hexane-1,3-dione (PubChem CID 123907711) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-imino-1-(4-phenylphenyl)hexane-1,3-dione.
| Compound Name | 2-imino-1-(4-phenylphenyl)hexane-1,3-dione |
|---|---|
| PubChem CID | 123907711 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-imino-1-(4-phenylphenyl)hexane-1,3-dione |
| SMILES | [H]/N=C(\C(=O)CCC)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO2/c1-2-6-16(20)17(19)18(21)15-11-9-14(10-12-15)13-7-4-3-5-8-13/h3-5,7-12,19H,2,6H2,1H3/b19-17+ |
| InChIKey | JEUGRMMFJOTFRF-HTXNQAPBSA-N |
| XLogP | 3.93 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|