C26H23F3N2O2S — CID 91216603
[2-methyl-4-[2-[2-[4-(trifluoromethyl)phenyl]indazol-6-yl]ethylsulfanyl]phenyl] propanoate (PubChem CID 91216603) has the molecular formula C26H23F3N2O2S and a molecular weight of 484.54 g/mol. Its IUPAC name is [2-methyl-4-[2-[2-[4-(trifluoromethyl)phenyl]indazol-6-yl]ethylsulfanyl]phenyl] propanoate.
| Compound Name | [2-methyl-4-[2-[2-[4-(trifluoromethyl)phenyl]indazol-6-yl]ethylsulfanyl]phenyl] propanoate |
|---|---|
| PubChem CID | 91216603 |
| Molecular Formula | C26H23F3N2O2S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [2-methyl-4-[2-[2-[4-(trifluoromethyl)phenyl]indazol-6-yl]ethylsulfanyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(SCCc2ccc3cn(-c4ccc(C(F)(F)F)cc4)nc3c2)cc1C |
| InChI | InChI=1S/C26H23F3N2O2S/c1-3-25(32)33-24-11-10-22(14-17(24)2)34-13-12-18-4-5-19-16-31(30-23(19)15-18)21-8-6-20(7-9-21)26(27,28)29/h4-11,14-16H,3,12-13H2,1-2H3 |
| InChIKey | FVOMEBWSSVPGNP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|