C14H22NO6P — CID 91218628
[hydroxy(phenoxy)phosphoryl] (2S)-2-amino-3-pentoxypropanoate (PubChem CID 91218628) has the molecular formula C14H22NO6P and a molecular weight of 331.30 g/mol. Its IUPAC name is [hydroxy(phenoxy)phosphoryl] (2S)-2-amino-3-pentoxypropanoate.
| Compound Name | [hydroxy(phenoxy)phosphoryl] (2S)-2-amino-3-pentoxypropanoate |
|---|---|
| PubChem CID | 91218628 |
| Molecular Formula | C14H22NO6P |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [hydroxy(phenoxy)phosphoryl] (2S)-2-amino-3-pentoxypropanoate |
| SMILES | CCCCCOC[C@H](N)C(=O)OP(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C14H22NO6P/c1-2-3-7-10-19-11-13(15)14(16)21-22(17,18)20-12-8-5-4-6-9-12/h4-6,8-9,13H,2-3,7,10-11,15H2,1H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | MTAHJINHJXKJCB-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|