C16H17F2N3O — CID 9121907
N-[(Z)-4-[4-(difluoromethoxy)phenyl]butan-2-ylideneamino]pyridin-2-amine (PubChem CID 9121907) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[(Z)-4-[4-(difluoromethoxy)phenyl]butan-2-ylideneamino]pyridin-2-amine.
| Compound Name | N-[(Z)-4-[4-(difluoromethoxy)phenyl]butan-2-ylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 9121907 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[(Z)-4-[4-(difluoromethoxy)phenyl]butan-2-ylideneamino]pyridin-2-amine |
| SMILES | C/C(CCc1ccc(OC(F)F)cc1)=N/Nc1ccccn1 |
| InChI | InChI=1S/C16H17F2N3O/c1-12(20-21-15-4-2-3-11-19-15)5-6-13-7-9-14(10-8-13)22-16(17)18/h2-4,7-11,16H,5-6H2,1H3,(H,19,21)/b20-12- |
| InChIKey | YGYWJWVUFWGTAY-NDENLUEZSA-N |
| XLogP | 4.10 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|