C14H10F3N — CID 91219654
3,4-dimethylidene-5-[3-(trifluoromethyl)phenyl]pyridine (PubChem CID 91219654) has the molecular formula C14H10F3N and a molecular weight of 249.23 g/mol. Its IUPAC name is 3,4-dimethylidene-5-[3-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 3,4-dimethylidene-5-[3-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 91219654 |
| Molecular Formula | C14H10F3N |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3,4-dimethylidene-5-[3-(trifluoromethyl)phenyl]pyridine |
| SMILES | C=c1cncc(-c2cccc(C(F)(F)F)c2)c1=C |
| InChI | InChI=1S/C14H10F3N/c1-9-7-18-8-13(10(9)2)11-4-3-5-12(6-11)14(15,16)17/h3-8H,1-2H2 |
| InChIKey | FQINQNPFPUXQHJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |