C19H25NO3 — CID 91219990
(3S,7aR)-7a-hexyl-7-methoxy-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 91219990) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (3S,7aR)-7a-hexyl-7-methoxy-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (3S,7aR)-7a-hexyl-7-methoxy-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 91219990 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (3S,7aR)-7a-hexyl-7-methoxy-3-phenyl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | CCCCCC[C@]12OC[C@H](c3ccccc3)N1C(=O)C=C2OC |
| InChI | InChI=1S/C19H25NO3/c1-3-4-5-9-12-19-17(22-2)13-18(21)20(19)16(14-23-19)15-10-7-6-8-11-15/h6-8,10-11,13,16H,3-5,9,12,14H2,1-2H3/t16-,19-/m1/s1 |
| InChIKey | VATKYQCANZARFD-VQIMIIECSA-N |
| XLogP | 3.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|