C24H25N3O2 — CID 91220665
N-methoxy-5-(5-piperidin-4-yl-2-pyridin-4-ylfuran-3-yl)-3H-inden-1-amine (PubChem CID 91220665) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-methoxy-5-(5-piperidin-4-yl-2-pyridin-4-ylfuran-3-yl)-3H-inden-1-amine.
| Compound Name | N-methoxy-5-(5-piperidin-4-yl-2-pyridin-4-ylfuran-3-yl)-3H-inden-1-amine |
|---|---|
| PubChem CID | 91220665 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-methoxy-5-(5-piperidin-4-yl-2-pyridin-4-ylfuran-3-yl)-3H-inden-1-amine |
| SMILES | CONC1=CCc2cc(-c3cc(C4CCNCC4)oc3-c3ccncc3)ccc21 |
| InChI | InChI=1S/C24H25N3O2/c1-28-27-22-5-3-18-14-19(2-4-20(18)22)21-15-23(16-6-10-25-11-7-16)29-24(21)17-8-12-26-13-9-17/h2,4-5,8-9,12-16,25,27H,3,6-7,10-11H2,1H3 |
| InChIKey | ISDIWBSFWXQXIQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|