C23H20BrN3O4 — CID 91222311
ethyl 7-(bromomethyl)-2,4-dioxo-1,5-diphenyl-5,6-dihydropyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 91222311) has the molecular formula C23H20BrN3O4 and a molecular weight of 482.33 g/mol. Its IUPAC name is ethyl 7-(bromomethyl)-2,4-dioxo-1,5-diphenyl-5,6-dihydropyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(bromomethyl)-2,4-dioxo-1,5-diphenyl-5,6-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 91222311 |
| Molecular Formula | C23H20BrN3O4 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | ethyl 7-(bromomethyl)-2,4-dioxo-1,5-diphenyl-5,6-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1C(CBr)=Nc2c(c(=O)[nH]c(=O)n2-c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C23H20BrN3O4/c1-2-31-22(29)18-16(13-24)25-20-19(17(18)14-9-5-3-6-10-14)21(28)26-23(30)27(20)15-11-7-4-8-12-15/h3-12,17-18H,2,13H2,1H3,(H,26,28,30) |
| InChIKey | HVQJQGSKHRXXAS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|