C21H23BrN4O3S — CID 91222911
3-[4-[6-amino-8-(3-bromophenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl]propane-1-sulfonic acid (PubChem CID 91222911) has the molecular formula C21H23BrN4O3S and a molecular weight of 491.41 g/mol. Its IUPAC name is 3-[4-[6-amino-8-(3-bromophenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[6-amino-8-(3-bromophenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91222911 |
| Molecular Formula | C21H23BrN4O3S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 3-[4-[6-amino-8-(3-bromophenyl)-3,4-dihydro-2H-imidazo[1,5-a]pyrimidin-8-yl]phenyl]propane-1-sulfonic acid |
| SMILES | NC1=NC(c2ccc(CCCS(=O)(=O)O)cc2)(c2cccc(Br)c2)C2=NCCCN12 |
| InChI | InChI=1S/C21H23BrN4O3S/c22-18-6-1-5-17(14-18)21(19-24-11-3-12-26(19)20(23)25-21)16-9-7-15(8-10-16)4-2-13-30(27,28)29/h1,5-10,14H,2-4,11-13H2,(H2,23,25)(H,27,28,29) |
| InChIKey | PVRGTVCDCYQZLT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|