C24H25NOP+ — CID 91223463
(4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)methyl-methyl-diphenylphosphanium (PubChem CID 91223463) has the molecular formula C24H25NOP+ and a molecular weight of 374.44 g/mol. Its IUPAC name is (4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)methyl-methyl-diphenylphosphanium.
| Compound Name | (4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)methyl-methyl-diphenylphosphanium |
|---|---|
| PubChem CID | 91223463 |
| Molecular Formula | C24H25NOP+ |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (4-benzyl-4,5-dihydro-1,3-oxazol-2-yl)methyl-methyl-diphenylphosphanium |
| SMILES | C[P+](CC1=NC(Cc2ccccc2)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NOP/c1-27(22-13-7-3-8-14-22,23-15-9-4-10-16-23)19-24-25-21(18-26-24)17-20-11-5-2-6-12-20/h2-16,21H,17-19H2,1H3/q+1 |
| InChIKey | WAEUOXUNDIQPER-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|