C24H17F2NO2 — CID 91223753
6-[(3,4-difluorophenyl)methyl]-7-hydroxy-8-methyl-2-(2-phenylethynyl)-1H-indolizin-5-one (PubChem CID 91223753) has the molecular formula C24H17F2NO2 and a molecular weight of 389.40 g/mol. Its IUPAC name is 6-[(3,4-difluorophenyl)methyl]-7-hydroxy-8-methyl-2-(2-phenylethynyl)-1H-indolizin-5-one.
| Compound Name | 6-[(3,4-difluorophenyl)methyl]-7-hydroxy-8-methyl-2-(2-phenylethynyl)-1H-indolizin-5-one |
|---|---|
| PubChem CID | 91223753 |
| Molecular Formula | C24H17F2NO2 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 6-[(3,4-difluorophenyl)methyl]-7-hydroxy-8-methyl-2-(2-phenylethynyl)-1H-indolizin-5-one |
| SMILES | Cc1c(O)c(Cc2ccc(F)c(F)c2)c(=O)n2c1CC(C#Cc1ccccc1)=C2 |
| InChI | InChI=1S/C24H17F2NO2/c1-15-22-13-18(8-7-16-5-3-2-4-6-16)14-27(22)24(29)19(23(15)28)11-17-9-10-20(25)21(26)12-17/h2-6,9-10,12,14,28H,11,13H2,1H3 |
| InChIKey | QAGQGJILRAOKJL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|