C29H48N2O6 — CID 91225037
3-(4-methylpentylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;2-(4-methylpentylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 91225037) has the molecular formula C29H48N2O6 and a molecular weight of 520.71 g/mol. Its IUPAC name is 3-(4-methylpentylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;2-(4-methylpentylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(4-methylpentylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;2-(4-methylpentylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 91225037 |
| Molecular Formula | C29H48N2O6 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.35 |
| IUPAC Name | 3-(4-methylpentylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;2-(4-methylpentylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CCCNC(=O)C1C2C=CC(C2)C1C(=O)O.CC(C)CCCNC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C15H23NO3.C14H25NO3/c1-9(2)4-3-7-16-14(17)12-10-5-6-11(8-10)13(12)15(18)19;1-10(2)6-5-9-15-13(16)11-7-3-4-8-12(11)14(17)18/h5-6,9-13H,3-4,7-8H2,1-2H3,(H,16,17)(H,18,19);10-12H,3-9H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | KCWBBANLRWJKJM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|