C8H16N2O4S — CID 91225784
(2R)-2-[(2-amino-2-methylpropanoyl)oxyamino]-2-methyl-3-sulfanylpropanoic acid (PubChem CID 91225784) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is (2R)-2-[(2-amino-2-methylpropanoyl)oxyamino]-2-methyl-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-amino-2-methylpropanoyl)oxyamino]-2-methyl-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 91225784 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2R)-2-[(2-amino-2-methylpropanoyl)oxyamino]-2-methyl-3-sulfanylpropanoic acid |
| SMILES | CC(C)(N)C(=O)ON[C@@](C)(CS)C(=O)O |
| InChI | InChI=1S/C8H16N2O4S/c1-7(2,9)6(13)14-10-8(3,4-15)5(11)12/h10,15H,4,9H2,1-3H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | PSEWXEIMPMOBLJ-QMMMGPOBSA-N |
| XLogP | -0.46 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|