C29H30N6O2 — CID 91226793
tert-butyl N-[[4-[5-[N-(1-aminoethylidene)carbamimidoyl]-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl]carbamate (PubChem CID 91226793) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is tert-butyl N-[[4-[5-[N-(1-aminoethylidene)carbamimidoyl]-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[5-[N-(1-aminoethylidene)carbamimidoyl]-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 91226793 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | tert-butyl N-[[4-[5-[N-(1-aminoethylidene)carbamimidoyl]-3-phenyl-1,6-naphthyridin-2-yl]phenyl]methyl]carbamate |
| SMILES | [H]/N=C(\N=C(/C)N)c1nccc2nc(-c3ccc(CNC(=O)OC(C)(C)C)cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C29H30N6O2/c1-18(30)34-27(31)26-23-16-22(20-8-6-5-7-9-20)25(35-24(23)14-15-32-26)21-12-10-19(11-13-21)17-33-28(36)37-29(2,3)4/h5-16H,17H2,1-4H3,(H,33,36)(H3,30,31,34) |
| InChIKey | QONZGSHFSGGOLX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|