C32H42N8O2 — CID 91230076
4-[9-methyl-2-[1-(2-methylprop-2-enyl)indol-3-yl]-8-[(4-morpholin-4-ylpiperidin-1-yl)methyl]purin-6-yl]morpholine (PubChem CID 91230076) has the molecular formula C32H42N8O2 and a molecular weight of 570.74 g/mol. Its IUPAC name is 4-[9-methyl-2-[1-(2-methylprop-2-enyl)indol-3-yl]-8-[(4-morpholin-4-ylpiperidin-1-yl)methyl]purin-6-yl]morpholine.
| Compound Name | 4-[9-methyl-2-[1-(2-methylprop-2-enyl)indol-3-yl]-8-[(4-morpholin-4-ylpiperidin-1-yl)methyl]purin-6-yl]morpholine |
|---|---|
| PubChem CID | 91230076 |
| Molecular Formula | C32H42N8O2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | 4-[9-methyl-2-[1-(2-methylprop-2-enyl)indol-3-yl]-8-[(4-morpholin-4-ylpiperidin-1-yl)methyl]purin-6-yl]morpholine |
| SMILES | C=C(C)Cn1cc(-c2nc(N3CCOCC3)c3nc(CN4CCC(N5CCOCC5)CC4)n(C)c3n2)c2ccccc21 |
| InChI | InChI=1S/C32H42N8O2/c1-23(2)20-40-21-26(25-6-4-5-7-27(25)40)30-34-31-29(32(35-30)39-14-18-42-19-15-39)33-28(36(31)3)22-37-10-8-24(9-11-37)38-12-16-41-17-13-38/h4-7,21,24H,1,8-20,22H2,2-3H3 |
| InChIKey | LAVCINVREJKCQH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|