C26H31ClF2N6O5S — CID 91232360
[(2S)-2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]-5-(dimethylsulfamoylamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 91232360) has the molecular formula C26H31ClF2N6O5S and a molecular weight of 613.09 g/mol. Its IUPAC name is [(2S)-2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]-5-(dimethylsulfamoylamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | [(2S)-2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]-5-(dimethylsulfamoylamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 91232360 |
| Molecular Formula | C26H31ClF2N6O5S |
| Molecular Weight | 613.09 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | [(2S)-2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]-5-(dimethylsulfamoylamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | CN(C)S(=O)(=O)NCCC[C@@H](COC(=O)Nc1cc2cc(F)ccc2cn1)NC(=O)CNCc1cccc(F)c1Cl |
| InChI | InChI=1S/C26H31ClF2N6O5S/c1-35(2)41(38,39)32-10-4-6-21(33-24(36)15-30-13-18-5-3-7-22(29)25(18)27)16-40-26(37)34-23-12-19-11-20(28)9-8-17(19)14-31-23/h3,5,7-9,11-12,14,21,30,32H,4,6,10,13,15-16H2,1-2H3,(H,33,36)(H,31,34,37)/t21-/m0/s1 |
| InChIKey | LZAYYJXYDJMLOZ-NRFANRHFSA-N |
| XLogP | 3.17 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.09 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|