C9H19NO — CID 91234260
2,2,3,3-tetramethyl-1-oxidopiperidin-1-ium (PubChem CID 91234260) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-1-oxidopiperidin-1-ium.
| Compound Name | 2,2,3,3-tetramethyl-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 91234260 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2,2,3,3-tetramethyl-1-oxidopiperidin-1-ium |
| SMILES | CC1(C)CCC[NH+]([O-])C1(C)C |
| InChI | InChI=1S/C9H19NO/c1-8(2)6-5-7-10(11)9(8,3)4/h10H,5-7H2,1-4H3 |
| InChIKey | VQBGSCNXHBPYEG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |