C17H27NO — CID 91234378
2-(2-methylhepta-3,5-dienyl)-2-azaspiro[4.5]decan-1-one (PubChem CID 91234378) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-(2-methylhepta-3,5-dienyl)-2-azaspiro[4.5]decan-1-one.
| Compound Name | 2-(2-methylhepta-3,5-dienyl)-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 91234378 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2-(2-methylhepta-3,5-dienyl)-2-azaspiro[4.5]decan-1-one |
| SMILES | CC=CC=CC(C)CN1CCC2(CCCCC2)C1=O |
| InChI | InChI=1S/C17H27NO/c1-3-4-6-9-15(2)14-18-13-12-17(16(18)19)10-7-5-8-11-17/h3-4,6,9,15H,5,7-8,10-14H2,1-2H3 |
| InChIKey | AZTGJIGYVSQIIR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|