C15H27N3 — CID 91234805
ethane;3-(4-pyridin-2-ylpiperidin-1-yl)propan-1-amine (PubChem CID 91234805) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;3-(4-pyridin-2-ylpiperidin-1-yl)propan-1-amine.
| Compound Name | ethane;3-(4-pyridin-2-ylpiperidin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 91234805 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | ethane;3-(4-pyridin-2-ylpiperidin-1-yl)propan-1-amine |
| SMILES | CC.NCCCN1CCC(c2ccccn2)CC1 |
| InChI | InChI=1S/C13H21N3.C2H6/c14-7-3-9-16-10-5-12(6-11-16)13-4-1-2-8-15-13;1-2/h1-2,4,8,12H,3,5-7,9-11,14H2;1-2H3 |
| InChIKey | KSZTVJZOKRGNSY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |