C21H22FN3O6 — CID 91234831
(3R,5S)-5-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid (PubChem CID 91234831) has the molecular formula C21H22FN3O6 and a molecular weight of 431.42 g/mol. Its IUPAC name is (3R,5S)-5-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid.
| Compound Name | (3R,5S)-5-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid |
|---|---|
| PubChem CID | 91234831 |
| Molecular Formula | C21H22FN3O6 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (3R,5S)-5-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)N[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C21H22FN3O6/c1-9-16(8-14-13-5-11(22)3-4-15(13)24-20(14)30)23-10(2)19(9)21(31)25-17(27)6-12(26)7-18(28)29/h3-5,8,12,17,23,26-27H,6-7H2,1-2H3,(H,24,30)(H,25,31)(H,28,29)/t12-,17+/m1/s1 |
| InChIKey | UMCPSSMQJKWGOT-PXAZEXFGSA-N |
| XLogP | 1.54 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|