C21H21F2N3O6 — CID 91399003
(3R,5S)-5-[[5-[(4,5-difluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid (PubChem CID 91399003) has the molecular formula C21H21F2N3O6 and a molecular weight of 449.41 g/mol. Its IUPAC name is (3R,5S)-5-[[5-[(4,5-difluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid.
| Compound Name | (3R,5S)-5-[[5-[(4,5-difluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid |
|---|---|
| PubChem CID | 91399003 |
| Molecular Formula | C21H21F2N3O6 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (3R,5S)-5-[[5-[(4,5-difluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]-3,5-dihydroxypentanoic acid |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccc(F)c(F)c32)c(C)c1C(=O)N[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C21H21F2N3O6/c1-8-14(7-11-18-13(25-20(11)31)4-3-12(22)19(18)23)24-9(2)17(8)21(32)26-15(28)5-10(27)6-16(29)30/h3-4,7,10,15,24,27-28H,5-6H2,1-2H3,(H,25,31)(H,26,32)(H,29,30)/t10-,15+/m1/s1 |
| InChIKey | KDWVUVHCDGHPEE-BMIGLBTASA-N |
| XLogP | 1.68 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|