C62H60O6P2 — CID 91235074
[2-[2-bis[(4-methylnaphthalen-1-yl)oxy]phosphanyloxy-5-methylphenyl]-4-methylphenyl] bis(4-methylnaphthalen-1-yl) phosphite;ethane (PubChem CID 91235074) has the molecular formula C62H60O6P2 and a molecular weight of 963.10 g/mol. Its IUPAC name is [2-[2-bis[(4-methylnaphthalen-1-yl)oxy]phosphanyloxy-5-methylphenyl]-4-methylphenyl] bis(4-methylnaphthalen-1-yl) phosphite;ethane.
| Compound Name | [2-[2-bis[(4-methylnaphthalen-1-yl)oxy]phosphanyloxy-5-methylphenyl]-4-methylphenyl] bis(4-methylnaphthalen-1-yl) phosphite;ethane |
|---|---|
| PubChem CID | 91235074 |
| Molecular Formula | C62H60O6P2 |
| Molecular Weight | 963.10 g/mol |
| Exact Mass | 962.39 |
| IUPAC Name | [2-[2-bis[(4-methylnaphthalen-1-yl)oxy]phosphanyloxy-5-methylphenyl]-4-methylphenyl] bis(4-methylnaphthalen-1-yl) phosphite;ethane |
| SMILES | CC.CC.Cc1ccc(OP(Oc2ccc(C)c3ccccc23)Oc2ccc(C)c3ccccc23)c(-c2cc(C)ccc2OP(Oc2ccc(C)c3ccccc23)Oc2ccc(C)c3ccccc23)c1 |
| InChI | InChI=1S/C58H48O6P2.2C2H6/c1-37-23-29-57(63-65(59-53-31-25-39(3)43-15-7-11-19-47(43)53)60-54-32-26-40(4)44-16-8-12-20-48(44)54)51(35-37)52-36-38(2)24-30-58(52)64-66(61-55-33-27-41(5)45-17-9-13-21-49(45)55)62-56-34-28-42(6)46-18-10-14-22-50(46)56;2*1-2/h7-36H,1-6H3;2*1-2H3 |
| InChIKey | NBSLLKFLQGCDTG-UHFFFAOYSA-N |
| XLogP | 19.40 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.10 |
| LogP ≤ 5 | 19.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|