C22H38O2 — CID 91235271
4-ethyl-1-(4-ethyl-2,2-dimethylnonoxy)-2-methoxybenzene (PubChem CID 91235271) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 4-ethyl-1-(4-ethyl-2,2-dimethylnonoxy)-2-methoxybenzene.
| Compound Name | 4-ethyl-1-(4-ethyl-2,2-dimethylnonoxy)-2-methoxybenzene |
|---|---|
| PubChem CID | 91235271 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 4-ethyl-1-(4-ethyl-2,2-dimethylnonoxy)-2-methoxybenzene |
| SMILES | CCCCCC(CC)CC(C)(C)COc1ccc(CC)cc1OC |
| InChI | InChI=1S/C22H38O2/c1-7-10-11-12-19(9-3)16-22(4,5)17-24-20-14-13-18(8-2)15-21(20)23-6/h13-15,19H,7-12,16-17H2,1-6H3 |
| InChIKey | BNEFVYGUUWEODO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|