C13H24F4O2 — CID 91236008
1-butan-2-yloxybut-3-en-2-one;fluoromethane;1,1,1-trifluorobutane (PubChem CID 91236008) has the molecular formula C13H24F4O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is 1-butan-2-yloxybut-3-en-2-one;fluoromethane;1,1,1-trifluorobutane.
| Compound Name | 1-butan-2-yloxybut-3-en-2-one;fluoromethane;1,1,1-trifluorobutane |
|---|---|
| PubChem CID | 91236008 |
| Molecular Formula | C13H24F4O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-butan-2-yloxybut-3-en-2-one;fluoromethane;1,1,1-trifluorobutane |
| SMILES | C=CC(=O)COC(C)CC.CCCC(F)(F)F.CF |
| InChI | InChI=1S/C8H14O2.C4H7F3.CH3F/c1-4-7(3)10-6-8(9)5-2;1-2-3-4(5,6)7;1-2/h5,7H,2,4,6H2,1,3H3;2-3H2,1H3;1H3 |
| InChIKey | WRFJFUXIWWAJFE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|