C11H12F4O4 — CID 162215109
1-[3-(1,1-difluoro-2-oxobut-3-enoxy)propoxy]-1,1-difluorobut-3-en-2-one (PubChem CID 162215109) has the molecular formula C11H12F4O4 and a molecular weight of 284.21 g/mol. Its IUPAC name is 1-[3-(1,1-difluoro-2-oxobut-3-enoxy)propoxy]-1,1-difluorobut-3-en-2-one.
| Compound Name | 1-[3-(1,1-difluoro-2-oxobut-3-enoxy)propoxy]-1,1-difluorobut-3-en-2-one |
|---|---|
| PubChem CID | 162215109 |
| Molecular Formula | C11H12F4O4 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-[3-(1,1-difluoro-2-oxobut-3-enoxy)propoxy]-1,1-difluorobut-3-en-2-one |
| SMILES | C=CC(=O)C(F)(F)OCCCOC(F)(F)C(=O)C=C |
| InChI | InChI=1S/C11H12F4O4/c1-3-8(16)10(12,13)18-6-5-7-19-11(14,15)9(17)4-2/h3-4H,1-2,5-7H2 |
| InChIKey | SSKVERUJHUUJNG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|