C17H33NO5 — CID 91237011
2-(dihydroxymethyl)-N-[2-(1-hydroxy-2,2-dimethylbutoxy)ethyl]-N-methylcyclohexane-1-carboxamide (PubChem CID 91237011) has the molecular formula C17H33NO5 and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-(dihydroxymethyl)-N-[2-(1-hydroxy-2,2-dimethylbutoxy)ethyl]-N-methylcyclohexane-1-carboxamide.
| Compound Name | 2-(dihydroxymethyl)-N-[2-(1-hydroxy-2,2-dimethylbutoxy)ethyl]-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91237011 |
| Molecular Formula | C17H33NO5 |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 2-(dihydroxymethyl)-N-[2-(1-hydroxy-2,2-dimethylbutoxy)ethyl]-N-methylcyclohexane-1-carboxamide |
| SMILES | CCC(C)(C)C(O)OCCN(C)C(=O)C1CCCCC1C(O)O |
| InChI | InChI=1S/C17H33NO5/c1-5-17(2,3)16(22)23-11-10-18(4)14(19)12-8-6-7-9-13(12)15(20)21/h12-13,15-16,20-22H,5-11H2,1-4H3 |
| InChIKey | PBNYCEACCGPVJW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|