C27H45NO6 — CID 91237102
9-but-3-en-2-ylidene-8-[(2-methylpropan-2-yl)oxycarbonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]tridec-10-enoic acid (PubChem CID 91237102) has the molecular formula C27H45NO6 and a molecular weight of 479.66 g/mol. Its IUPAC name is 9-but-3-en-2-ylidene-8-[(2-methylpropan-2-yl)oxycarbonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]tridec-10-enoic acid.
| Compound Name | 9-but-3-en-2-ylidene-8-[(2-methylpropan-2-yl)oxycarbonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]tridec-10-enoic acid |
|---|---|
| PubChem CID | 91237102 |
| Molecular Formula | C27H45NO6 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | 9-but-3-en-2-ylidene-8-[(2-methylpropan-2-yl)oxycarbonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]tridec-10-enoic acid |
| SMILES | C=CC(C)=C(C=CCC)C(CCCCCC(NC(=O)OC(C)(C)C)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H45NO6/c1-10-12-16-20(19(3)11-2)21(24(31)33-26(4,5)6)17-14-13-15-18-22(23(29)30)28-25(32)34-27(7,8)9/h11-12,16,21-22H,2,10,13-15,17-18H2,1,3-9H3,(H,28,32)(H,29,30) |
| InChIKey | GAIYQLADPGRAPG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|