C20H19ClF3N7O2 — CID 91237399
1-[2-[4-[4-chloro-3-(trifluoromethoxy)phenyl]piperazin-1-yl]-2-oxoethyl]pyrazolo[5,4-b]pyridine-3-carboximidamide (PubChem CID 91237399) has the molecular formula C20H19ClF3N7O2 and a molecular weight of 481.87 g/mol. Its IUPAC name is 1-[2-[4-[4-chloro-3-(trifluoromethoxy)phenyl]piperazin-1-yl]-2-oxoethyl]pyrazolo[5,4-b]pyridine-3-carboximidamide.
| Compound Name | 1-[2-[4-[4-chloro-3-(trifluoromethoxy)phenyl]piperazin-1-yl]-2-oxoethyl]pyrazolo[5,4-b]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 91237399 |
| Molecular Formula | C20H19ClF3N7O2 |
| Molecular Weight | 481.87 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 1-[2-[4-[4-chloro-3-(trifluoromethoxy)phenyl]piperazin-1-yl]-2-oxoethyl]pyrazolo[5,4-b]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1nn(CC(=O)N2CCN(c3ccc(Cl)c(OC(F)(F)F)c3)CC2)c2ncccc12 |
| InChI | InChI=1S/C20H19ClF3N7O2/c21-14-4-3-12(10-15(14)33-20(22,23)24)29-6-8-30(9-7-29)16(32)11-31-19-13(2-1-5-27-19)17(28-31)18(25)26/h1-5,10H,6-9,11H2,(H3,25,26) |
| InChIKey | POZIBHLWNZFYMW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|