C30H31N9O8 — CID 91237632
benzotriazol-1-yl 4-acetamido-1-methylpyrrole-2-carboxylate;ethyl (E)-3-[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrol-2-yl]prop-2-enoate (PubChem CID 91237632) has the molecular formula C30H31N9O8 and a molecular weight of 645.63 g/mol. Its IUPAC name is benzotriazol-1-yl 4-acetamido-1-methylpyrrole-2-carboxylate;ethyl (E)-3-[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrol-2-yl]prop-2-enoate.
| Compound Name | benzotriazol-1-yl 4-acetamido-1-methylpyrrole-2-carboxylate;ethyl (E)-3-[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91237632 |
| Molecular Formula | C30H31N9O8 |
| Molecular Weight | 645.63 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | benzotriazol-1-yl 4-acetamido-1-methylpyrrole-2-carboxylate;ethyl (E)-3-[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrol-2-yl]prop-2-enoate |
| SMILES | CC(=O)Nc1cc(C(=O)On2nnc3ccccc32)n(C)c1.CCOC(=O)/C=C/c1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cn1C |
| InChI | InChI=1S/C16H18N4O5.C14H13N5O3/c1-4-25-15(21)6-5-12-7-11(9-18(12)2)17-16(22)14-8-13(20(23)24)10-19(14)3;1-9(20)15-10-7-13(18(2)8-10)14(21)22-19-12-6-4-3-5-11(12)16-17-19/h5-10H,4H2,1-3H3,(H,17,22);3-8H,1-2H3,(H,15,20)/b6-5+; |
| InChIKey | QSPKUHRRQIJTNZ-IPZCTEOASA-N |
| XLogP | 3.10 |
| TPSA | 199.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|