C44H71N7O5 — CID 91237880
[4-[[4,6-bis[4-[2-ethylhexoxy(hydroxy)methyl]anilino]-1,3,5-triazinan-2-yl]amino]phenyl]-(tert-butylamino)methanol (PubChem CID 91237880) has the molecular formula C44H71N7O5 and a molecular weight of 778.10 g/mol. Its IUPAC name is [4-[[4,6-bis[4-[2-ethylhexoxy(hydroxy)methyl]anilino]-1,3,5-triazinan-2-yl]amino]phenyl]-(tert-butylamino)methanol.
| Compound Name | [4-[[4,6-bis[4-[2-ethylhexoxy(hydroxy)methyl]anilino]-1,3,5-triazinan-2-yl]amino]phenyl]-(tert-butylamino)methanol |
|---|---|
| PubChem CID | 91237880 |
| Molecular Formula | C44H71N7O5 |
| Molecular Weight | 778.10 g/mol |
| Exact Mass | 777.55 |
| IUPAC Name | [4-[[4,6-bis[4-[2-ethylhexoxy(hydroxy)methyl]anilino]-1,3,5-triazinan-2-yl]amino]phenyl]-(tert-butylamino)methanol |
| SMILES | CCCCC(CC)COC(O)c1ccc(NC2NC(Nc3ccc(C(O)NC(C)(C)C)cc3)NC(Nc3ccc(C(O)OCC(CC)CCCC)cc3)N2)cc1 |
| InChI | InChI=1S/C44H71N7O5/c1-8-12-14-30(10-3)28-55-39(53)33-18-24-36(25-19-33)46-42-48-41(45-35-22-16-32(17-23-35)38(52)51-44(5,6)7)49-43(50-42)47-37-26-20-34(21-27-37)40(54)56-29-31(11-4)15-13-9-2/h16-27,30-31,38-43,45-54H,8-15,28-29H2,1-7H3 |
| InChIKey | CWKCAQGANYJROM-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 163.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.10 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|