About bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate
bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate (PubChem CID 118499992) has the molecular formula C25H49NO4
and a molecular weight of 427.67 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate.
Molecular Properties
| Compound Name | bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate |
| PubChem CID | 118499992 |
| Molecular Formula | C25H49NO4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate |
| SMILES | CCCCC(CC)COC(=O)CC(CNC(C)(C)C)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C25H49NO4/c1-8-12-14-20(10-3)18-29-23(27)16-22(17-26-25(5,6)7)24(28)30-19-21(11-4)15-13-9-2/h20-22,26H,8-19H2,1-7H3 |
| InChIKey | IVLIIVYWRBDAJF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate?
The IUPAC name of bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate (CID 118499992) is bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate.
What is the SMILES notation for bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate?
The canonical SMILES for bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate is CCCCC(CC)COC(=O)CC(CNC(C)(C)C)C(=O)OCC(CC)CCCC.
What is the InChIKey of bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate?
The InChIKey is IVLIIVYWRBDAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H49NO4/c1-8-12-14-20(10-3)18-29-23(27)16-22(17-26-25(5,6)7)24(28)30-19-21(11-4)15-13-9-2/h20-22,26H,8-19H2,1-7H3.
What are the key properties of bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate?
bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate has a molecular weight of 427.67 g/mol, XLogP of 5.90, 17 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexyl) 2-[(tert-butylamino)methyl]butanedioate is sourced from PubChem (CID 118499992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).